CAS 321-30-2 appears in our catalog under these names: Adenine sulphate, min. 95 %, 2 kg, 7H-Purin-6-amine sulfate (2:1), 98%, Adenine Hemisulfate, >95% (HPLC), 7H-Purin-6-amine Sulphate (Adenine Sulphate), Adenine hemisulfate/ 99.78% (existing batch purity). Offered by: Roth, Fluorochem, TRC, Mikromol, TargetMol. Available pack sizes: 2kg, 5g, 25g, 100g, 500g, 50g, 4x25mg, 25mg.
Bis(7H-purin-6-amine);sulfuric acid (CAS 321-30-2) is a chemical compound with the molecular formula C10H12N10O4S and a molecular weight of 368.34 g/mol. IUPAC name: bis(7H-purin-6-amine);sulfuric acid. InChIKey: LQXHSCOPYJCOMD-UHFFFAOYSA-N.
| Molecular formula | C10H12N10O4S |
|---|---|
| Molecular weight | 368.34 g/mol |
| IUPAC name | bis(7H-purin-6-amine);sulfuric acid |
| InChIKey | LQXHSCOPYJCOMD-UHFFFAOYSA-N |
| SMILES | C1=NC2=NC=NC(=C2N1)N.C1=NC2=NC=NC(=C2N1)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)