Agar
cas: 9002-18-0 — see every product listed under this CAS number, including other names
Agar (CAS 9002-18-0) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 0,5kg, 2kg, 5kg, 100G, 10KG, 25KG, 500G. Offered by: Biosynth, Sigma-Aldrich.
| brand | Biosynth |
|---|---|
| catalog number | OA39737-1kg |
| cas | 9002-18-0 |
| size | 1kg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Biosynth | 1kg | price on request | |
| Biosynth | 0,5kg | price on request | |
| Biosynth | 2kg | price on request | |
| Biosynth | 5kg | price on request | |
| Sigma-Aldrich | 100G | 508.40 Pln | |
| Sigma-Aldrich | 10KG | 12472.00 Pln | |
| Sigma-Aldrich | 1KG | 2396.00 Pln | |
| Sigma-Aldrich | 25KG | 22614.00 Pln | |
| Sigma-Aldrich | 500G | 1615.00 Pln | |
| Sigma-Aldrich | 5KG | 8886.00 Pln | |
| Sigma-Aldrich | 100G | 408.30 Pln | |
| Sigma-Aldrich | 1KG | 2220.00 Pln | |
| Sigma-Aldrich | 250G | 799.90 Pln | |
| Sigma-Aldrich | 500G | 1417.00 Pln | |
| Sigma-Aldrich | 5KG | 8523.00 Pln | |
| Sigma-Aldrich | 50G | 138.80 Pln | |
| Sigma-Aldrich | 500G | 594.20 Pln |
properties
| category | Carbohydrates |
|---|---|
| sub-category 1 | Oligosaccharides |
| purity | No data |
| delivery time | 3-4 weeks |
(2R,3S,4S,5R)-2-(hydroxymethyl)-6-[[(4R,5S)-4-hydroxy-3-methyl-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-4-methoxyoxane-3,5-diol (CAS 9002-18-0) is a chemical compound with the molecular formula C14H24O9 and a molecular weight of 336.33 g/mol. IUPAC name: (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[[(4R,5S)-4-hydroxy-3-methyl-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-4-methoxyoxane-3,5-diol. InChIKey: GYYDPBCUIJTIBM-DYOGSRDZSA-N.
| Molecular formula | C14H24O9 |
|---|---|
| Molecular weight | 336.33 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[[(4R,5S)-4-hydroxy-3-methyl-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-4-methoxyoxane-3,5-diol |
| InChIKey | GYYDPBCUIJTIBM-DYOGSRDZSA-N |
| SMILES | CC1[C@H]([C@H]2C(C(O1)CO2)OC3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)OC)O)O |
Computed by PubChem (NCBI)