cas: 173334-58-2 — see every product listed under this CAS number, including other names
Aliskiren hemifumarate 98% (CAS 173334-58-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A201324-1mg |
| cas | 173334-58-2 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 125.62 Pln | |
| Ambeed | 10mg | 170.12 Pln | |
| Ambeed | 50mg | 298.06 Pln | |
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 693.00 Pln | |
| Ambeed | 1g | 1649.75 Pln | |
| Ambeed | 5g | 5849.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A201324 |
Bis((2S,4S,5S,7S)-5-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide);(E)-but-2-enedioic acid (CAS 173334-58-2) is a chemical compound with the molecular formula C64H110N6O16 and a molecular weight of 1219.6 g/mol. IUPAC name: bis((2S,4S,5S,7S)-5-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide);(E)-but-2-enedioic acid. InChIKey: KLRSDBSKUSSCGU-KRQUFFFQSA-N.
| Molecular formula | C64H110N6O16 |
|---|---|
| Molecular weight | 1219.6 g/mol |
| IUPAC name | bis((2S,4S,5S,7S)-5-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide);(E)-but-2-enedioic acid |
| InChIKey | KLRSDBSKUSSCGU-KRQUFFFQSA-N |
| SMILES | CC(C)[C@@H](CC1=CC(=C(C=C1)OC)OCCCOC)C[C@@H]([C@H](C[C@@H](C(C)C)C(=O)NCC(C)(C)C(=O)N)O)N.CC(C)[C@@H](CC1=CC(=C(C=C1)OC)OCCCOC)C[C@@H]([C@H](C[C@@H](C(C)C)C(=O)NCC(C)(C)C(=O)N)O)N.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)