cas: 59338-87-3 — see every product listed under this CAS number, including other names
Alizapride HCl 99+% (CAS 59338-87-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A201469-1mg |
| cas | 59338-87-3 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 120.06 Pln | |
| Ambeed | 10mg | 159.00 Pln | |
| Ambeed | 50mg | 242.44 Pln | |
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 492.75 Pln | |
| Ambeed | 1g | 1060.12 Pln | |
| Ambeed | 5g | 3546.56 Pln |
| purity | 99+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A201469 |
6-methoxy-N-[(1-prop-2-enylpyrrolidin-2-yl)methyl]-3H-benzotriazole-5-carboxamide;hydrochloride (CAS 59338-87-3) is a chemical compound with the molecular formula C16H22ClN5O2 and a molecular weight of 351.8 g/mol. IUPAC name: 6-methoxy-N-[(1-prop-2-enylpyrrolidin-2-yl)methyl]-3H-benzotriazole-5-carboxamide;hydrochloride. InChIKey: BRECEDGYMYXGNF-UHFFFAOYSA-N.
| Molecular formula | C16H22ClN5O2 |
|---|---|
| Molecular weight | 351.8 g/mol |
| IUPAC name | 6-methoxy-N-[(1-prop-2-enylpyrrolidin-2-yl)methyl]-3H-benzotriazole-5-carboxamide;hydrochloride |
| InChIKey | BRECEDGYMYXGNF-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1C(=O)NCC3CCCN3CC=C)NN=N2.Cl |
Computed by PubChem (NCBI)