cas: 110637-53-1 — see every product listed under this CAS number, including other names
Alloc-Lys(Boc)-OH.DCHA 98% (CAS 110637-53-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A793833-250mg |
| cas | 110637-53-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1744.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A793833 |
N-cyclohexylcyclohexanamine;(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(prop-2-enoxycarbonylamino)hexanoic acid (CAS 110637-53-1) is a chemical compound with the molecular formula C27H49N3O6 and a molecular weight of 511.7 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(prop-2-enoxycarbonylamino)hexanoic acid. InChIKey: LCXGOTRBZAEQQR-MERQFXBCSA-N.
| Molecular formula | C27H49N3O6 |
|---|---|
| Molecular weight | 511.7 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(prop-2-enoxycarbonylamino)hexanoic acid |
| InChIKey | LCXGOTRBZAEQQR-MERQFXBCSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC=C.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)