CAS 27511-79-1 appears in our catalog under these names: 3-Amino-4-carbamoylpyrazole Hemisulfate, >95% (HPLC), 5-Amino-1H-pyrazole-4-carboxamide Hemisulphate, 3–Amino–4–pyrazolecarboxamide hemisulfate salt, 3-Amino-4-carbamoylpyrazole hemisulfate, 3-Aminopyrazole-4-carboxamide Hemisulfate, >98.0%(T). Offered by: TRC, Mikromol, GLPBio, Biosynth, TCI. Available pack sizes: 5g, 25mg, 100g, 500g, 25g, 10g, 50g, 1000g.
Bis(5-amino-1H-pyrazole-4-carboxamide);sulfuric acid (CAS 27511-79-1) is a chemical compound with the molecular formula C8H14N8O6S and a molecular weight of 350.32 g/mol. IUPAC name: bis(5-amino-1H-pyrazole-4-carboxamide);sulfuric acid. InChIKey: UMPKASYMNORSRO-UHFFFAOYSA-N.
| Molecular formula | C8H14N8O6S |
|---|---|
| Molecular weight | 350.32 g/mol |
| IUPAC name | bis(5-amino-1H-pyrazole-4-carboxamide);sulfuric acid |
| InChIKey | UMPKASYMNORSRO-UHFFFAOYSA-N |
| SMILES | C1=NNC(=C1C(=O)N)N.C1=NNC(=C1C(=O)N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)