Allyl 3-amino-4-fluorobenzoate, 97%
cas: 153774-39-1 — see every product listed under this CAS number, including other names
Allyl 3-amino-4-fluorobenzoate, 97% (CAS 153774-39-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A197000-250mg |
| cas | 153774-39-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 481.62 Pln | |
| Ambeed | 5g | 1499.56 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 410.00 Pln | |
| Chemat | 5g | 1288.40 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 514.29 Pln | |
| BLDpharm | 5g | 1608.35 Pln | |
| Fluorochem | 1g | 492.55 Pln | |
| Fluorochem | 5g | 1554.68 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Prop-2-enyl 3-amino-4-fluorobenzoate (CAS 153774-39-1) is a chemical compound with the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. IUPAC name: prop-2-enyl 3-amino-4-fluorobenzoate. InChIKey: SNZWNIMUYPJNCE-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO2 |
|---|---|
| Molecular weight | 195.19 g/mol |
| IUPAC name | prop-2-enyl 3-amino-4-fluorobenzoate |
| InChIKey | SNZWNIMUYPJNCE-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)C1=CC(=C(C=C1)F)N |
Computed by PubChem (NCBI)