Almonertinib 99%
cas: 1899921-05-1 — see every product listed under this CAS number, including other names
Almonertinib 99% (CAS 1899921-05-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1005335-1mg |
| cas | 1899921-05-1 |
| size | 1mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 275.81 Pln | |
| Ambeed | 2mg | 325.88 Pln | |
| Ambeed | 5mg | 398.19 Pln | |
| Ambeed | 10mg | 492.75 Pln | |
| Ambeed | 25mg | 620.69 Pln | |
| Ambeed | 50mg | 782.00 Pln | |
| Ambeed | 100mg | 1277.06 Pln | |
| Ambeed | 250mg | 2356.19 Pln | |
| Ambeed | 1g | 8063.31 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1005335 |
N-[5-[[4-(1-cyclopropylindol-3-yl)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide (CAS 1899921-05-1) is a chemical compound with the molecular formula C30H35N7O2 and a molecular weight of 525.6 g/mol. IUPAC name: N-[5-[[4-(1-cyclopropylindol-3-yl)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide. InChIKey: DOEOECWDNSEFDN-UHFFFAOYSA-N.
| Molecular formula | C30H35N7O2 |
|---|---|
| Molecular weight | 525.6 g/mol |
| IUPAC name | N-[5-[[4-(1-cyclopropylindol-3-yl)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide |
| InChIKey | DOEOECWDNSEFDN-UHFFFAOYSA-N |
| SMILES | CN(C)CCN(C)C1=CC(=C(C=C1NC(=O)C=C)NC2=NC=CC(=N2)C3=CN(C4=CC=CC=C43)C5CC5)OC |
Computed by PubChem (NCBI)