cas: 479200-82-3 — see every product listed under this CAS number, including other names
Amino-PEG11-amine, 95%, 95% (CAS 479200-82-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DLZC-100mg |
| cas | 479200-82-3 |
| size | 100mg |
| availability | 0.45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1mg | 170.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (CAS 479200-82-3) is a chemical compound with the molecular formula C24H52N2O11 and a molecular weight of 544.7 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: TZQCFDTWLKAGLL-UHFFFAOYSA-N.
| Molecular formula | C24H52N2O11 |
|---|---|
| Molecular weight | 544.7 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | TZQCFDTWLKAGLL-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN)N |
Computed by PubChem (NCBI)