CAS 581065-95-4 appears in our catalog under these names: H2N-PEG(4)-CO-OtBu, Amino-dPEG®,4-t-Butyl Ester, Amino-PEG4-Boc/ min. 98%, Amino–PEG4–Boc, tert-Butyl 1-Amino-3,6,9,12-tetraoxapentadecan-15-oate, >95.0%(T). Offered by: Iris Biotech, Biosynth, TargetMol, GLPBio, TCI. Available pack sizes: 1g, 100mg, 1000mg, 50mg, 250mg, 2g, 5g, 10g.
Tert-butyl 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanoate (CAS 581065-95-4) is a chemical compound with the molecular formula C15H31NO6 and a molecular weight of 321.41 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: PKESARRNSGIDRD-UHFFFAOYSA-N.
| Molecular formula | C15H31NO6 |
|---|---|
| Molecular weight | 321.41 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | PKESARRNSGIDRD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)