Amino-PEG8-Acid, 95%, 95%
cas: 756526-04-2 — see every product listed under this CAS number, including other names
Amino-PEG8-Acid, 95%, 95% (CAS 756526-04-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 100g, 250g, 500g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G7V0-10g |
| cas | 756526-04-2 |
| size | 10g |
| availability | 1000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1302.80 Pln | |
| Chemat | 50g | 3645.20 Pln | |
| Chemat | 100g | 6266.00 Pln | |
| Chemat | 250g | 11128.40 Pln | |
| Chemat | 500g | 20798.40 Pln | |
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 25g | 2128.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 756526-04-2) is a chemical compound with the molecular formula C19H39NO10 and a molecular weight of 441.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: YLKOHZCQTVYVDB-UHFFFAOYSA-N.
| Molecular formula | C19H39NO10 |
|---|---|
| Molecular weight | 441.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | YLKOHZCQTVYVDB-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCN)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Amino-PEG8-Acid, 27-Amino-4,7,10,13,16,19,22,25-octaoxaheptacosanoic acid, Amino-PEG8-COOH, alpha-amine-omega-propionic acid octaethylene glycol, Amino-PEG8-propionic acid, Amine-PEG8-COOH, Amino-dPEG(R)8-acid, alpha-amine-omega-propioni, orb1909314, |A-amine-|O-propionic acid octaethylene glycol