CAS 106214-84-0 appears in our catalog under these names: POLY(DIMETHYLSILOXANE), BIS(3-AMINOPROP&, Siloxanes and Silicones, di-Me, 3-aminopropyl group-terminated, Aminopropyl terminated Polydimethylsiloxanes 10-15 cSt, average Mn ~2,500, Aminopropyl Terminated Polydimethylsiloxane cSt900-1100. Offered by: Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 10ML, 50ML, 1g, 5g, 25g, 100g, 300g, 400g.
3-[[[3-aminopropyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propan-1-amine (CAS 106214-84-0) is a chemical compound with the molecular formula C12H34N2O2Si3 and a molecular weight of 322.67 g/mol. IUPAC name: 3-[[[3-aminopropyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propan-1-amine. InChIKey: ZWRBLCDTKAWRHT-UHFFFAOYSA-N.
| Molecular formula | C12H34N2O2Si3 |
|---|---|
| Molecular weight | 322.67 g/mol |
| IUPAC name | 3-[[[3-aminopropyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propan-1-amine |
| InChIKey | ZWRBLCDTKAWRHT-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CCCN)O[Si](C)(C)O[Si](C)(C)CCCN |
Computed by PubChem (NCBI)