Anhydrotetracycline (hydrochloride), 99.68%
cas: 13803-65-1 — see every product listed under this CAS number, including other names
Anhydrotetracycline (hydrochloride), 99.68% (CAS 13803-65-1) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 25 mg, 10 mg, 50 mg, 100 mg, 5 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-118660-10mM/1mL |
| cas | 13803-65-1 |
| size | 10mM/1mL |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 584.40 Pln | |
| MedChemExpress | 25 mg | 1262.42 Pln | |
| MedChemExpress | 10 mg | 793.38 Pln | |
| MedChemExpress | 50 mg | 1559.64 Pln | |
| MedChemExpress | 100 mg | 1847.57 Pln | |
| MedChemExpress | 5 mg | 575.11 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.68% |
(4S,4aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide;hydrochloride (CAS 13803-65-1) is a chemical compound with the molecular formula C22H23ClN2O7 and a molecular weight of 462.9 g/mol. IUPAC name: (4S,4aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide;hydrochloride. InChIKey: SPFAOPCHYIJPHJ-WPJNXPDPSA-N.
| Molecular formula | C22H23ClN2O7 |
|---|---|
| Molecular weight | 462.9 g/mol |
| IUPAC name | (4S,4aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide;hydrochloride |
| InChIKey | SPFAOPCHYIJPHJ-WPJNXPDPSA-N |
| SMILES | CC1=C2C=CC=C(C2=C(C3=C1C[C@H]4[C@@H](C(=O)C(=C([C@]4(C3=O)O)O)C(=O)N)N(C)C)O)O.Cl |
Computed by PubChem (NCBI)