cas: 36443-68-2 — see every product listed under this CAS number, including other names
Antioxidant 245, 98% (CAS 36443-68-2) is a chemical reagent available from Chemat. Available pack sizes: 500 g, 1 kg, 100 g, 25g, 100g, 500g, 1kg. Offered by: MedChemExpress, Fluorochem.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-136779-500 g |
| cas | 36443-68-2 |
| size | 500 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 500 g | 551.89 Pln | |
| MedChemExpress | 1 kg | 895.55 Pln | |
| MedChemExpress | 100 g | 240.74 Pln | |
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 100g | 164.54 Pln | |
| Fluorochem | 500g | 445.69 Pln | |
| Fluorochem | 1kg | 804.94 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98% |
2-[2-[2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyloxy]ethoxy]ethoxy]ethyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate (CAS 36443-68-2) is a chemical compound with the molecular formula C34H50O8 and a molecular weight of 586.8 g/mol. IUPAC name: 2-[2-[2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyloxy]ethoxy]ethoxy]ethyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate. InChIKey: QSRJVOOOWGXUDY-UHFFFAOYSA-N.
| Molecular formula | C34H50O8 |
|---|---|
| Molecular weight | 586.8 g/mol |
| IUPAC name | 2-[2-[2-[3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoyloxy]ethoxy]ethoxy]ethyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate |
| InChIKey | QSRJVOOOWGXUDY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)C(C)(C)C)CCC(=O)OCCOCCOCCOC(=O)CCC2=CC(=C(C(=C2)C)O)C(C)(C)C |
Computed by PubChem (NCBI)