CAS 23661-03-2 appears in our catalog under these names: Antiviral agent 24, N-[[3-(Trifluoromethyl)phenyl]methyl]adenosine, 99%, 99%, Antiviral agent 24, 99.63%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 5mg, 10mM/1mL, 25 mg, 10 mg, 5 mg.
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[[3-(trifluoromethyl)phenyl]methylamino]purin-9-yl]oxolane-3,4-diol (CAS 23661-03-2) is a chemical compound with the molecular formula C18H18F3N5O4 and a molecular weight of 425.4 g/mol. IUPAC name: (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[[3-(trifluoromethyl)phenyl]methylamino]purin-9-yl]oxolane-3,4-diol. InChIKey: SDQKDCSBWUSBDO-LSCFUAHRSA-N.
| Molecular formula | C18H18F3N5O4 |
|---|---|
| Molecular weight | 425.4 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[[3-(trifluoromethyl)phenyl]methylamino]purin-9-yl]oxolane-3,4-diol |
| InChIKey | SDQKDCSBWUSBDO-LSCFUAHRSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CNC2=C3C(=NC=N2)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O |
Computed by PubChem (NCBI)