cas: 243975-37-3 — see every product listed under this CAS number, including other names
Argifin 98% (CAS 243975-37-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1365834-100mg |
| cas | 243975-37-3 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 6661.56 Pln | |
| Ambeed | 1mg | 387.06 Pln | |
| Ambeed | 5mg | 887.69 Pln | |
| Ambeed | 10mg | 1460.62 Pln | |
| Ambeed | 25mg | 2467.44 Pln | |
| Ambeed | 50mg | 4186.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1365834 |
(2R,5S,8S,11S,15S)-5-[3-[[amino-(methylcarbamoylamino)methylidene]amino]propyl]-8-benzyl-2,7-dimethyl-3,6,9,13,17-pentaoxo-1,4,7,10,14-pentazacycloheptadecane-11,15-dicarboxylic acid (CAS 243975-37-3) is a chemical compound with the molecular formula C29H41N9O10 and a molecular weight of 675.7 g/mol. IUPAC name: (2R,5S,8S,11S,15S)-5-[3-[[amino-(methylcarbamoylamino)methylidene]amino]propyl]-8-benzyl-2,7-dimethyl-3,6,9,13,17-pentaoxo-1,4,7,10,14-pentazacycloheptadecane-11,15-dicarboxylic acid. InChIKey: UHBHXSDKGLPPGO-HTDHLNIYSA-N.
| Molecular formula | C29H41N9O10 |
|---|---|
| Molecular weight | 675.7 g/mol |
| IUPAC name | (2R,5S,8S,11S,15S)-5-[3-[[amino-(methylcarbamoylamino)methylidene]amino]propyl]-8-benzyl-2,7-dimethyl-3,6,9,13,17-pentaoxo-1,4,7,10,14-pentazacycloheptadecane-11,15-dicarboxylic acid |
| InChIKey | UHBHXSDKGLPPGO-HTDHLNIYSA-N |
| SMILES | C[C@@H]1C(=O)N[C@H](C(=O)N([C@H](C(=O)N[C@@H](CC(=O)N[C@@H](CC(=O)N1)C(=O)O)C(=O)O)CC2=CC=CC=C2)C)CCCN=C(N)NC(=O)NC |
Computed by PubChem (NCBI)