cas: 50906-56-4 — see every product listed under this CAS number, including other names
Arteannuin B 98% (CAS 50906-56-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5mg, 25mg, 50mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A365685-100mg |
| cas | 50906-56-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1588.56 Pln | |
| Ambeed | 5mg | 348.12 Pln | |
| Ambeed | 25mg | 698.56 Pln | |
| Ambeed | 50mg | 1015.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A365685 |
(1R,5S,8R,9S,12R,14R)-8,12-dimethyl-4-methylidene-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-3-one (CAS 50906-56-4) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. IUPAC name: (1R,5S,8R,9S,12R,14R)-8,12-dimethyl-4-methylidene-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-3-one. InChIKey: QWQSMEDUZQDVLA-KPHNHPKPSA-N.
| Molecular formula | C15H20O3 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | (1R,5S,8R,9S,12R,14R)-8,12-dimethyl-4-methylidene-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-3-one |
| InChIKey | QWQSMEDUZQDVLA-KPHNHPKPSA-N |
| SMILES | C[C@@H]1CC[C@H]2C(=C)C(=O)O[C@]23[C@H]1CC[C@@]4([C@H]3O4)C |
Computed by PubChem (NCBI)