cas: 102130-43-8 — see every product listed under this CAS number, including other names
Atractyloside potassium salt 97% (CAS 102130-43-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A230303-1mg |
| cas | 102130-43-8 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 203.50 Pln | |
| Ambeed | 5mg | 476.06 Pln | |
| Ambeed | 10mg | 676.31 Pln | |
| Ambeed | 25mg | 1099.06 Pln | |
| Ambeed | 50mg | 1877.81 Pln | |
| Ambeed | 100mg | 3335.19 Pln | |
| Ambeed | 250mg | 6049.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A230303 |
Dipotassium;[(2S,3R,4R,5R,6R)-2-[[(1R,4R,5R,7R,9R,10S,13R,15S)-5-carboxy-15-hydroxy-9-methyl-14-methylidene-7-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]oxy]-6-(hydroxymethyl)-3-(3-methylbutanoyloxy)-5-sulfonatooxyoxan-4-yl] sulfate (CAS 102130-43-8) is a chemical compound with the molecular formula C30H44K2O16S2 and a molecular weight of 803.0 g/mol. IUPAC name: dipotassium;[(2S,3R,4R,5R,6R)-2-[[(1R,4R,5R,7R,9R,10S,13R,15S)-5-carboxy-15-hydroxy-9-methyl-14-methylidene-7-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]oxy]-6-(hydroxymethyl)-3-(3-methylbutanoyloxy)-5-sulfonatooxyoxan-4-yl] sulfate. InChIKey: IUCNQFHEWLYECJ-VCQILIGCSA-L.
| Molecular formula | C30H44K2O16S2 |
|---|---|
| Molecular weight | 803.0 g/mol |
| IUPAC name | dipotassium;[(2S,3R,4R,5R,6R)-2-[[(1R,4R,5R,7R,9R,10S,13R,15S)-5-carboxy-15-hydroxy-9-methyl-14-methylidene-7-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]oxy]-6-(hydroxymethyl)-3-(3-methylbutanoyloxy)-5-sulfonatooxyoxan-4-yl] sulfate |
| InChIKey | IUCNQFHEWLYECJ-VCQILIGCSA-L |
| SMILES | CC(C)CC(=O)O[C@@H]1[C@H]([C@@H]([C@H](O[C@@H]1O[C@@H]2C[C@H]([C@H]3CC[C@@]45C[C@@H](CC[C@H]4[C@@]3(C2)C)C(=C)[C@@H]5O)C(=O)O)CO)OS(=O)(=O)[O-])OS(=O)(=O)[O-].[K+].[K+] |
Computed by PubChem (NCBI)