cas: 1644443-47-9 — see every product listed under this CAS number, including other names
Autophinib, 99%, 99% (CAS 1644443-47-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12ENHN-1mg |
| cas | 1644443-47-9 |
| size | 1mg |
| availability | 3g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 88.40 Pln | |
| Chemat | 2mg | 102.80 Pln | |
| Chemat | 5mg | 112.40 Pln | |
| Chemat | 10mg | 131.60 Pln | |
| Chemat | 50mg | 304.40 Pln | |
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 760.40 Pln | |
| Chemat | 1g | 1950.80 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-(4-nitrophenoxy)pyrimidin-4-amine (CAS 1644443-47-9) is a chemical compound with the molecular formula C14H11ClN6O3 and a molecular weight of 346.73 g/mol. IUPAC name: 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-(4-nitrophenoxy)pyrimidin-4-amine. InChIKey: CEUMAXLRGBKFQP-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN6O3 |
|---|---|
| Molecular weight | 346.73 g/mol |
| IUPAC name | 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-(4-nitrophenoxy)pyrimidin-4-amine |
| InChIKey | CEUMAXLRGBKFQP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1)NC2=CC(=NC(=N2)OC3=CC=C(C=C3)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)