Azathramycin, 96%, 96%
cas: 76801-85-9 — see every product listed under this CAS number, including other names
Azathramycin, 96%, 96% (CAS 76801-85-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116I9G-250mg |
| cas | 76801-85-9 |
| size | 250mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 25g | 597.20 Pln | |
| Chemat | 100g | 1830.80 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(2R,3S,4R,5R,8R,10R,11R,12S,13S,14R)-11-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-2-ethyl-3,4,10-trihydroxy-13-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,8,10,12,14-hexamethyl-1-oxa-6-azacyclopentadecan-15-one (CAS 76801-85-9) is a chemical compound with the molecular formula C37H70N2O12 and a molecular weight of 735.0 g/mol. IUPAC name: (2R,3S,4R,5R,8R,10R,11R,12S,13S,14R)-11-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-2-ethyl-3,4,10-trihydroxy-13-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,8,10,12,14-hexamethyl-1-oxa-6-azacyclopentadecan-15-one. InChIKey: HRKNNHYKWGYTEN-HOQMJRDDSA-N.
| Molecular formula | C37H70N2O12 |
|---|---|
| Molecular weight | 735.0 g/mol |
| IUPAC name | (2R,3S,4R,5R,8R,10R,11R,12S,13S,14R)-11-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-2-ethyl-3,4,10-trihydroxy-13-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,8,10,12,14-hexamethyl-1-oxa-6-azacyclopentadecan-15-one |
| InChIKey | HRKNNHYKWGYTEN-HOQMJRDDSA-N |
| SMILES | CC[C@@H]1[C@@]([C@@H]([C@H](NC[C@@H](C[C@@]([C@@H]([C@H]([C@@H]([C@H](C(=O)O1)C)O[C@H]2C[C@@]([C@H]([C@@H](O2)C)O)(C)OC)C)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)(C)O)C)C)O)(C)O |
Computed by PubChem (NCBI)
Synonyms:
Azaerythromycin A, DD-Azaerythromycin A, 9-Deoxo-9a-aza-9a-homoerythromycin A, 10-Dihydro-10-deoxo-11-azaerythromycin A, Azathramycin, Azithromycin EP Impurity A, 9-Deoxo-9a-aza-9a-homo Erythromycin A, Azaerythromycin, 9-Deoxo-9a-aza-9a-homo Erythromycin A(Desmethyl Azithromycin), 9-Deoxo-9a-aza-9a-homo Erythromycin A Desmethyl Azithromycin