CAS 1314533-27-1 appears in our catalog under these names: MSDC-0602K/ 99.89% (existing batch purity), MSDC–0602K, Potassium 5-(4-(2-(3-methoxyphenyl)-2-oxoethoxy)benzyl)-2,4-dioxothiazolidin-3-ide, Azemiglitazone (potassium), 98.94%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
Potassium 5-[[4-[2-(3-methoxyphenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-3-ide-2,4-dione (CAS 1314533-27-1) is a chemical compound with the molecular formula C19H16KNO5S and a molecular weight of 409.5 g/mol. IUPAC name: potassium 5-[[4-[2-(3-methoxyphenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-3-ide-2,4-dione. InChIKey: PQCFIIIBRQVVGW-UHFFFAOYSA-M.
| Molecular formula | C19H16KNO5S |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | potassium 5-[[4-[2-(3-methoxyphenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidin-3-ide-2,4-dione |
| InChIKey | PQCFIIIBRQVVGW-UHFFFAOYSA-M |
| SMILES | COC1=CC=CC(=C1)C(=O)COC2=CC=C(C=C2)CC3C(=O)[N-]C(=O)S3.[K+] |
Computed by PubChem (NCBI)