Azide-PEG5-Tos, 98%, 98%
cas: 236754-49-7 — see every product listed under this CAS number, including other names
Azide-PEG5-Tos, 98%, 98% (CAS 236754-49-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I5KW-100mg |
| cas | 236754-49-7 |
| size | 100mg |
| availability | 500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 818.00 Pln | |
| Chemat | 10g | 1163.60 Pln | |
| Chemat | 25g | 1994.00 Pln | |
| Chemat | 50g | 3645.20 Pln | |
| Chemat | 100g | 5574.80 Pln | |
| Chemat | 250g | 6698.00 Pln | |
| Chemat | 500g | 11937.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 236754-49-7) is a chemical compound with the molecular formula C17H27N3O7S and a molecular weight of 417.5 g/mol. IUPAC name: 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: RCRFPWKHJGMATE-UHFFFAOYSA-N.
| Molecular formula | C17H27N3O7S |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | RCRFPWKHJGMATE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCCN=[N+]=[N-] |
Computed by PubChem (NCBI)