CAS 1422540-98-4 appears in our catalog under these names: Azido-PEG4-4-nitrophenyl carbonate, Azido–PEG4–4–nitrophenyl carbonate, Azido-PEG4-4-nitrophenyl carbonate, 98.88%, Azido-PEG4-4-nitrophenyl carbonate, 97%, Azido-PEG4-4-nitrophenyl carbonate, 95%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress, Fluorochem. Available pack sizes: 5mg, 10mg, 100mg, 250mg, 500mg, 100 mg, 250 mg, 1g.
2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl (4-nitrophenyl) carbonate (CAS 1422540-98-4) is a chemical compound with the molecular formula C15H20N4O8 and a molecular weight of 384.34 g/mol. IUPAC name: 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl (4-nitrophenyl) carbonate. InChIKey: NEBKYWFZPUXXJD-UHFFFAOYSA-N.
| Molecular formula | C15H20N4O8 |
|---|---|
| Molecular weight | 384.34 g/mol |
| IUPAC name | 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl (4-nitrophenyl) carbonate |
| InChIKey | NEBKYWFZPUXXJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC(=O)OCCOCCOCCOCCN=[N+]=[N-] |
Computed by PubChem (NCBI)