cas: 86770-67-4 — see every product listed under this CAS number, including other names
Azido-PEG4-alcohol, 97%, 97% (CAS 86770-67-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115SB7-250mg |
| cas | 86770-67-4 |
| size | 250mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 266.00 Pln | |
| Chemat | 10g | 458.00 Pln | |
| Chemat | 25g | 1005.20 Pln | |
| Chemat | 50g | 1773.20 Pln | |
| Chemat | 500g | 5289.60 Pln | |
| Chemat | 1kg | 8296.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethanol (CAS 86770-67-4) is a chemical compound with the molecular formula C8H17N3O4 and a molecular weight of 219.24 g/mol. IUPAC name: 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethanol. InChIKey: MBQYGQMGPFNSAP-UHFFFAOYSA-N.
| Molecular formula | C8H17N3O4 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethanol |
| InChIKey | MBQYGQMGPFNSAP-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCO)N=[N+]=[N-] |
Computed by PubChem (NCBI)