Azido-PEG8-acid, 98%
cas: 1214319-92-2 — see every product listed under this CAS number, including other names
Azido-PEG8-acid, 98% (CAS 1214319-92-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F986505-100MG |
| cas | 1214319-92-2 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 700.81 Pln | |
| Fluorochem | 250mg | 1127.75 Pln | |
| Fluorochem | 1g | 2444.99 Pln | |
| Fluorochem | 5g | 7063.16 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1214319-92-2) is a chemical compound with the molecular formula C19H37N3O10 and a molecular weight of 467.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: URUGOEBULOZLBF-UHFFFAOYSA-N.
| Molecular formula | C19H37N3O10 |
|---|---|
| Molecular weight | 467.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | URUGOEBULOZLBF-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)