cas: 890129-26-7 — see every product listed under this CAS number, including other names
BGG463 (CAS 890129-26-7) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 1mg, 2mg. Offered by: GLPBio, Biosynth, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC19067-10 |
| cas | 890129-26-7 |
| size | 10mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 1467.61 Pln | |
| GLPBio | 100mg | 4416.33 Pln | |
| GLPBio | 25mg | 2310.10 Pln | |
| GLPBio | 5mg | 1046.37 Pln | |
| GLPBio | 50mg | 3152.59 Pln | |
| Biosynth | 10mg | price on request | |
| Biosynth | 25mg | price on request | |
| Chemat | 10mg | 7159.39 Pln | |
| Chemat | 1mg | 2183.26 Pln | |
| Chemat | 5mg | 4347.45 Pln | |
| Biosynth | 50mg | price on request | |
| Chemat | 2mg | 525.20 Pln | |
| Chemat | 1mg | 376.40 Pln | |
| Chemat | 5mg | 885.20 Pln | |
| Chemat | 10mg | 1418.00 Pln | |
| Chemat | 25mg | 2574.80 Pln | |
| Chemat | 50mg | 3693.20 Pln | |
| Chemat | 100mg | 5186.00 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
6-(6-acetamidopyrimidin-4-yl)oxy-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide (CAS 890129-26-7) is a chemical compound with the molecular formula C30H29F3N6O3 and a molecular weight of 578.6 g/mol. IUPAC name: 6-(6-acetamidopyrimidin-4-yl)oxy-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide. InChIKey: MZZJNOOADWVFPD-UHFFFAOYSA-N.
| Molecular formula | C30H29F3N6O3 |
|---|---|
| Molecular weight | 578.6 g/mol |
| IUPAC name | 6-(6-acetamidopyrimidin-4-yl)oxy-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide |
| InChIKey | MZZJNOOADWVFPD-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=NC=N1)OC2=CC3=C(C=C2)C(=CC=C3)C(=O)NC4=CC(=C(C=C4)CN5CCN(CC5)C)C(F)(F)F |
Computed by PubChem (NCBI)