cas: 2483-48-9 — see every product listed under this CAS number, including other names
BIS-N,N'-BOC-L-LYSINE METHYL ESTER, 95% (CAS 2483-48-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F513648-1G |
| cas | 2483-48-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 565.44 Pln | |
| Fluorochem | 25g | 1736.91 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (CAS 2483-48-9) is a chemical compound with the molecular formula C17H32N2O6 and a molecular weight of 360.4 g/mol. IUPAC name: methyl (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate. InChIKey: WLPJOHSPBBUIQG-LBPRGKRZSA-N.
| Molecular formula | C17H32N2O6 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | methyl (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| InChIKey | WLPJOHSPBBUIQG-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)