cas: 543730-41-2 — see every product listed under this CAS number, including other names
BMS–538203 (CAS 543730-41-2) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 5mg, 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC10570-10 |
| cas | 543730-41-2 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 2197.77 Pln | |
| GLPBio | 100mg | 7453.97 Pln | |
| GLPBio | 5mg | 1584.63 Pln | |
| GLPBio | 50mg | 5670.70 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(Z)-4-[(4-fluorophenyl)methyl-methoxyamino]-2-hydroxy-4-oxobut-2-enoic acid (CAS 543730-41-2) is a chemical compound with the molecular formula C12H12FNO5 and a molecular weight of 269.23 g/mol. IUPAC name: (Z)-4-[(4-fluorophenyl)methyl-methoxyamino]-2-hydroxy-4-oxobut-2-enoic acid. InChIKey: GACIOSIZKMLELV-POHAHGRESA-N.
| Molecular formula | C12H12FNO5 |
|---|---|
| Molecular weight | 269.23 g/mol |
| IUPAC name | (Z)-4-[(4-fluorophenyl)methyl-methoxyamino]-2-hydroxy-4-oxobut-2-enoic acid |
| InChIKey | GACIOSIZKMLELV-POHAHGRESA-N |
| SMILES | CON(CC1=CC=C(C=C1)F)C(=O)/C=C(/C(=O)O)\O |
Computed by PubChem (NCBI)