Products 1629125-65-0
CAS 1629125-65-0 appears in our catalog under these names: IDO–IN–4, IDO-IN-4, 99.92%, 99.92%, BMS-978587, 99.92%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 10mM (in 1ml dmso), 2mg, 5mg, 50mg, 100 mg, 50 mg, 2 mg.
Cis-(1R,2S)-2-[4-[bis(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]cyclopropane-1-carboxylic acid (CAS 1629125-65-0) is a chemical compound with the molecular formula C26H35N3O3 and a molecular weight of 437.6 g/mol. IUPAC name: cis-(1R,2S)-2-[4-[bis(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]cyclopropane-1-carboxylic acid. InChIKey: VZYCPKLOYXSKAB-FGZHOGPDSA-N.
| Molecular formula | C26H35N3O3 |
|---|---|
| Molecular weight | 437.6 g/mol |
| IUPAC name | cis-(1R,2S)-2-[4-[bis(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | VZYCPKLOYXSKAB-FGZHOGPDSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)NC2=C(C=CC(=C2)[C@H]3C[C@H]3C(=O)O)N(CC(C)C)CC(C)C |
Computed by PubChem (NCBI)