cas: 909115-21-5 — see every product listed under this CAS number, including other names
BOC-THR(ALA-FMOC)-OH, ≥97%, ≥97% (CAS 909115-21-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11VQY1-250mg |
| cas | 909115-21-5 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 592.40 Pln | |
| Chemat | 5g | 2171.60 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
(2S,3R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 909115-21-5) is a chemical compound with the molecular formula C27H32N2O8 and a molecular weight of 512.6 g/mol. IUPAC name: (2S,3R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: QBYYWPMYAPYVGF-DMPWYTOCSA-N.
| Molecular formula | C27H32N2O8 |
|---|---|
| Molecular weight | 512.6 g/mol |
| IUPAC name | (2S,3R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | QBYYWPMYAPYVGF-DMPWYTOCSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OC(C)(C)C)OC(=O)[C@H](C)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)