cas: 252979-56-9 — see every product listed under this CAS number, including other names
Banoxantrone 2HCl 98% (CAS 252979-56-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A724668-1mg |
| cas | 252979-56-9 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 353.69 Pln | |
| Ambeed | 5mg | 409.31 Pln | |
| Ambeed | 10mg | 654.06 Pln | |
| Ambeed | 25mg | 1227.00 Pln | |
| Ambeed | 50mg | 2033.56 Pln | |
| Ambeed | 100mg | 3401.94 Pln | |
| Ambeed | 250mg | 6394.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A724668 |
2-[[4-[2-[dimethyl(oxido)azaniumyl]ethylamino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]-N,N-dimethylethanamine oxide;dihydrochloride (CAS 252979-56-9) is a chemical compound with the molecular formula C22H30Cl2N4O6 and a molecular weight of 517.4 g/mol. IUPAC name: 2-[[4-[2-[dimethyl(oxido)azaniumyl]ethylamino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]-N,N-dimethylethanamine oxide;dihydrochloride. InChIKey: SBWCPHUXRZRTDP-UHFFFAOYSA-N.
| Molecular formula | C22H30Cl2N4O6 |
|---|---|
| Molecular weight | 517.4 g/mol |
| IUPAC name | 2-[[4-[2-[dimethyl(oxido)azaniumyl]ethylamino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]-N,N-dimethylethanamine oxide;dihydrochloride |
| InChIKey | SBWCPHUXRZRTDP-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCNC1=C2C(=C(C=C1)NCC[N+](C)(C)[O-])C(=O)C3=C(C=CC(=C3C2=O)O)O)[O-].Cl.Cl |
Computed by PubChem (NCBI)