CAS 12084-29-6 appears in our catalog under these names: Barium2,4-pentanedionate, 98+%, Barium 2,4–pentanedionate, Barium 2,4-pentanedionate , Barium2,4-pentanedionate, ≥98%, ≥98%. Offered by: AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 5g, 10g, 50g, 25g, 100g, 250g.
Barium(2+);bis((Z)-4-oxopent-2-en-2-olate) (CAS 12084-29-6) is a chemical compound with the molecular formula C10H14BaO4 and a molecular weight of 335.54 g/mol. IUPAC name: barium(2+);bis((Z)-4-oxopent-2-en-2-olate). InChIKey: DJHZYHWLGNJISM-FDGPNNRMSA-L.
| Molecular formula | C10H14BaO4 |
|---|---|
| Molecular weight | 335.54 g/mol |
| IUPAC name | barium(2+);bis((Z)-4-oxopent-2-en-2-olate) |
| InChIKey | DJHZYHWLGNJISM-FDGPNNRMSA-L |
| SMILES | C/C(=C/C(=O)C)/[O-].C/C(=C/C(=O)C)/[O-].[Ba+2] |
Computed by PubChem (NCBI)