cas: 575-61-1 — see every product listed under this CAS number, including other names
Benzalphthalide 98% (CAS 575-61-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A534195-1g |
| cas | 575-61-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 25g | 281.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A534195 |
3-benzylidene-2-benzofuran-1-one (CAS 575-61-1) is a chemical compound with the molecular formula C15H10O2 and a molecular weight of 222.24 g/mol. IUPAC name: 3-benzylidene-2-benzofuran-1-one. InChIKey: YRTPZXMEBGTPLM-UHFFFAOYSA-N.
| Molecular formula | C15H10O2 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 3-benzylidene-2-benzofuran-1-one |
| InChIKey | YRTPZXMEBGTPLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=C2C3=CC=CC=C3C(=O)O2 |
Computed by PubChem (NCBI)