Benzamide, 2-[[2-chloro-5-(trifluoromethyl)-4-pyrimidinyl]amino]-N,3-dimethyl-, 95%, 95%
cas: 1022960-23-1 — see every product listed under this CAS number, including other names
Benzamide, 2-[[2-chloro-5-(trifluoromethyl)-4-pyrimidinyl]amino]-N,3-dimethyl-, 95%, 95% (CAS 1022960-23-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JOGL-100mg |
| cas | 1022960-23-1 |
| size | 100mg |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 650.00 Pln | |
| Chemat | 1g | 1442.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N,3-dimethylbenzamide (CAS 1022960-23-1) is a chemical compound with the molecular formula C14H12ClF3N4O and a molecular weight of 344.72 g/mol. IUPAC name: 2-[[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N,3-dimethylbenzamide. InChIKey: JSBNSMPWVFOKDS-UHFFFAOYSA-N.
| Molecular formula | C14H12ClF3N4O |
|---|---|
| Molecular weight | 344.72 g/mol |
| IUPAC name | 2-[[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N,3-dimethylbenzamide |
| InChIKey | JSBNSMPWVFOKDS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)NC)NC2=NC(=NC=C2C(F)(F)F)Cl |
Computed by PubChem (NCBI)
Synonyms:
Benzamide, 2-[[2-chloro-5-(trifluoromethyl)-4-pyrimidinyl]amino]-N,3-dimethyl-, 2-((2-Chloro-5-(trifluoromethyl)pyrimidin-4-yl)amino)-N,3-dimethylbenzamide, 2-[[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N,3-dimethylbenzamide, 2-{[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]amino}-N,3-dimethylbenzamide, C14H12ClF3N4O, 2-(2-chloro-5-trifluoromethyl-pyrimidin-4-ylamino)-3,N-dimethyl-benzamide, 2-[[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N,3-dimethyl-benzamide