cas: 79606-18-1 — see every product listed under this CAS number, including other names
Benzene, 1,1'-(1-pentyl-1,3-propanediyl)bis-, 97%, 97% (CAS 79606-18-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116J0K-100mg |
| cas | 79606-18-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 736.40 Pln | |
| Chemat | 250mg | 1427.60 Pln | |
| Chemat | 1g | 3410.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-phenyloctan-3-ylbenzene (CAS 79606-18-1) is a chemical compound with the molecular formula C20H26 and a molecular weight of 266.4 g/mol. IUPAC name: 1-phenyloctan-3-ylbenzene. InChIKey: VYDMDTJAGDKCFU-UHFFFAOYSA-N.
| Molecular formula | C20H26 |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | 1-phenyloctan-3-ylbenzene |
| InChIKey | VYDMDTJAGDKCFU-UHFFFAOYSA-N |
| SMILES | CCCCCC(CCC1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)