cas: 827-15-6 — see every product listed under this CAS number, including other names
Benzene, 1,2,3,4,5-pentafluoro-6-iodo-, 97%, 97% (CAS 827-15-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114D0N-1g |
| cas | 827-15-6 |
| size | 1g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 155.60 Pln | |
| Chemat | 25g | 280.40 Pln | |
| Chemat | 100g | 856.40 Pln | |
| Chemat | 500g | 3993.60 Pln | |
| Chemat | 50g | 477.20 Pln | |
| Chemat | 250g | 2003.60 Pln | |
| Chemat | 1kg | 5488.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1,2,3,4,5-pentafluoro-6-iodobenzene (CAS 827-15-6) is a chemical compound with the molecular formula C6F5I and a molecular weight of 293.96 g/mol. IUPAC name: 1,2,3,4,5-pentafluoro-6-iodobenzene. InChIKey: OPYHNLNYCRZOGY-UHFFFAOYSA-N.
| Molecular formula | C6F5I |
|---|---|
| Molecular weight | 293.96 g/mol |
| IUPAC name | 1,2,3,4,5-pentafluoro-6-iodobenzene |
| InChIKey | OPYHNLNYCRZOGY-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)I)F)F)F |
Computed by PubChem (NCBI)