cas: 1454653-66-7 — see every product listed under this CAS number, including other names
Benzenemethanamine, N-(4-methoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 95%, 95% (CAS 1454653-66-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FFYS-250mg |
| cas | 1454653-66-7 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 5229.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-methoxy-N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]aniline (CAS 1454653-66-7) is a chemical compound with the molecular formula C20H26BNO3 and a molecular weight of 339.2 g/mol. IUPAC name: 4-methoxy-N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]aniline. InChIKey: JQDIUHIUXGMSRK-UHFFFAOYSA-N.
| Molecular formula | C20H26BNO3 |
|---|---|
| Molecular weight | 339.2 g/mol |
| IUPAC name | 4-methoxy-N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]aniline |
| InChIKey | JQDIUHIUXGMSRK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CNC3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)