cas: 6272-40-8 — see every product listed under this CAS number, including other names
Benzofuran-2-yl(phenyl)methanone, 95%, 95% (CAS 6272-40-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EOKE-5g |
| cas | 6272-40-8 |
| size | 5g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 3534.80 Pln | |
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 410.00 Pln | |
| Chemat | 1g | 1010.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-benzofuran-2-yl(phenyl)methanone (CAS 6272-40-8) is a chemical compound with the molecular formula C15H10O2 and a molecular weight of 222.24 g/mol. IUPAC name: 1-benzofuran-2-yl(phenyl)methanone. InChIKey: DZRJNLPOTUVETG-UHFFFAOYSA-N.
| Molecular formula | C15H10O2 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 1-benzofuran-2-yl(phenyl)methanone |
| InChIKey | DZRJNLPOTUVETG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC3=CC=CC=C3O2 |
Computed by PubChem (NCBI)