cas: 79932-99-3 — see every product listed under this CAS number, including other names
Benzoic acid, 2-(diphenylphosphino)-, methyl ester, 95%, 95% (CAS 79932-99-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115Z9Y-1g |
| cas | 79932-99-3 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1202.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-diphenylphosphanylbenzoate (CAS 79932-99-3) is a chemical compound with the molecular formula C20H17O2P and a molecular weight of 320.3 g/mol. IUPAC name: methyl 2-diphenylphosphanylbenzoate. InChIKey: VWTREAQKLNMBGC-UHFFFAOYSA-N.
| Molecular formula | C20H17O2P |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | methyl 2-diphenylphosphanylbenzoate |
| InChIKey | VWTREAQKLNMBGC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC=C1P(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)