cas: 63451-28-5 — see every product listed under this CAS number, including other names
Benzoic acid, 2-[2-[4-(dimethylamino)phenyl]diazenyl]-, hydrochloride (1:1) (CAS 63451-28-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IB8X-5g |
| cas | 63451-28-5 |
| size | 5g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 126.80 Pln | |
| Chemat | 25g | 290.00 Pln | |
| Chemat | 100g | 717.20 Pln | |
| Chemat | 1g | 88.40 Pln |
| delivery time | 3 weeks |
|---|
2-[[4-(dimethylamino)phenyl]diazenyl]benzoic acid;hydrochloride (CAS 63451-28-5) is a chemical compound with the molecular formula C15H16ClN3O2 and a molecular weight of 305.76 g/mol. IUPAC name: 2-[[4-(dimethylamino)phenyl]diazenyl]benzoic acid;hydrochloride. InChIKey: ICTWKXAVJAHRMK-UHFFFAOYSA-N.
| Molecular formula | C15H16ClN3O2 |
|---|---|
| Molecular weight | 305.76 g/mol |
| IUPAC name | 2-[[4-(dimethylamino)phenyl]diazenyl]benzoic acid;hydrochloride |
| InChIKey | ICTWKXAVJAHRMK-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC=CC=C2C(=O)O.Cl |
Computed by PubChem (NCBI)