cas: 313-12-2 — see every product listed under this CAS number, including other names
Benzoic acid, 2-amino-3-(trifluoromethyl)-, 97%, 97% (CAS 313-12-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GCU-1g |
| cas | 313-12-2 |
| size | 1g |
| availability | 385g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 25g | 256.40 Pln | |
| Chemat | 100g | 736.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-amino-3-(trifluoromethyl)benzoic acid (CAS 313-12-2) is a chemical compound with the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. IUPAC name: 2-amino-3-(trifluoromethyl)benzoic acid. InChIKey: UNLVJVQEDSDPIN-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2 |
|---|---|
| Molecular weight | 205.13 g/mol |
| IUPAC name | 2-amino-3-(trifluoromethyl)benzoic acid |
| InChIKey | UNLVJVQEDSDPIN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)N)C(=O)O |
Computed by PubChem (NCBI)