cas: 3368-13-6 — see every product listed under this CAS number, including other names
Benzolamide (CAS 3368-13-6) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC62864-10 |
| cas | 3368-13-6 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 835.75 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 692.52 Pln | |
| GLPBio | 25mg | 1256.99 Pln | |
| GLPBio | 5mg | 667.25 Pln | |
| GLPBio | 50mg | 1678.24 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(benzenesulfonamido)-1,3,4-thiadiazole-2-sulfonamide (CAS 3368-13-6) is a chemical compound with the molecular formula C8H8N4O4S3 and a molecular weight of 320.4 g/mol. IUPAC name: 5-(benzenesulfonamido)-1,3,4-thiadiazole-2-sulfonamide. InChIKey: PWDGTQXZLNDOKS-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O4S3 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 5-(benzenesulfonamido)-1,3,4-thiadiazole-2-sulfonamide |
| InChIKey | PWDGTQXZLNDOKS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=NN=C(S2)S(=O)(=O)N |
Computed by PubChem (NCBI)