cas: 992-59-6 — see every product listed under this CAS number, including other names
Benzopurpurine 4B (CAS 992-59-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 1 g, 10 g, 50 g, 25 g, 5 g. Offered by: TCI, MedChemExpress.
| brand | TCI |
|---|---|
| catalog number | B0781-5G |
| cas | 992-59-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 2311.44 Pln | |
| TCI | 25g | 5532.24 Pln | |
| MedChemExpress | 1 g | 375.42 Pln | |
| MedChemExpress | 10 g | 1109.17 Pln | |
| MedChemExpress | 50 g | 3342.94 Pln | |
| MedChemExpress | 25 g | 2098.34 Pln | |
| MedChemExpress | 5 g | 746.94 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
Disodium;4-amino-3-[[4-[4-[(1-amino-4-sulfonatonaphthalen-2-yl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]naphthalene-1-sulfonate (CAS 992-59-6) is a chemical compound with the molecular formula C34H26N6Na2O6S2 and a molecular weight of 724.7 g/mol. IUPAC name: disodium;4-amino-3-[[4-[4-[(1-amino-4-sulfonatonaphthalen-2-yl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]naphthalene-1-sulfonate. InChIKey: SUXCALIDMIIJCK-UHFFFAOYSA-L.
| Molecular formula | C34H26N6Na2O6S2 |
|---|---|
| Molecular weight | 724.7 g/mol |
| IUPAC name | disodium;4-amino-3-[[4-[4-[(1-amino-4-sulfonatonaphthalen-2-yl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]naphthalene-1-sulfonate |
| InChIKey | SUXCALIDMIIJCK-UHFFFAOYSA-L |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N=NC3=C(C4=CC=CC=C4C(=C3)S(=O)(=O)[O-])N)C)N=NC5=C(C6=CC=CC=C6C(=C5)S(=O)(=O)[O-])N.[Na+].[Na+] |
Computed by PubChem (NCBI)