cas: 1219424-59-5 — see every product listed under this CAS number, including other names
Benzyl (1-benzyl-2,5-dioxopyrrolidin-3-yl)carbamate 95% (CAS 1219424-59-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A446509-5g |
| cas | 1219424-59-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 353.69 Pln | |
| Ambeed | 10g | 565.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A446509 |
Benzyl N-(1-benzyl-2,5-dioxopyrrolidin-3-yl)carbamate (CAS 1219424-59-5) is a chemical compound with the molecular formula C19H18N2O4 and a molecular weight of 338.4 g/mol. IUPAC name: benzyl N-(1-benzyl-2,5-dioxopyrrolidin-3-yl)carbamate. InChIKey: DRPFKGKSRKPPCG-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O4 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | benzyl N-(1-benzyl-2,5-dioxopyrrolidin-3-yl)carbamate |
| InChIKey | DRPFKGKSRKPPCG-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)N(C1=O)CC2=CC=CC=C2)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)