cas: 2377607-45-7 — see every product listed under this CAS number, including other names
Benzyl (2,3-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)carbamate 98% (CAS 2377607-45-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1379579-100mg |
| cas | 2377607-45-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 348.12 Pln | |
| Ambeed | 1g | 698.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1379579 |
Benzyl N-[2,3-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 2377607-45-7) is a chemical compound with the molecular formula C20H22BF2NO4 and a molecular weight of 389.2 g/mol. IUPAC name: benzyl N-[2,3-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: PEBTZBZQAGKOEW-UHFFFAOYSA-N.
| Molecular formula | C20H22BF2NO4 |
|---|---|
| Molecular weight | 389.2 g/mol |
| IUPAC name | benzyl N-[2,3-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | PEBTZBZQAGKOEW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)F)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)