cas: 13795-24-9 — see every product listed under this CAS number, including other names
Benzyl (4-nitrophenyl) carbonate, 97%, 97% (CAS 13795-24-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 250mg, 1g, 5g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1128Q4-10g |
| cas | 13795-24-9 |
| size | 10g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 198.80 Pln | |
| Chemat | 25g | 390.80 Pln | |
| Chemat | 50g | 683.60 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 100g | 1163.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl (4-nitrophenyl) carbonate (CAS 13795-24-9) is a chemical compound with the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. IUPAC name: benzyl (4-nitrophenyl) carbonate. InChIKey: QIXRWIVDBZJDGD-UHFFFAOYSA-N.
| Molecular formula | C14H11NO5 |
|---|---|
| Molecular weight | 273.24 g/mol |
| IUPAC name | benzyl (4-nitrophenyl) carbonate |
| InChIKey | QIXRWIVDBZJDGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)