cas: 132431-09-5 — see every product listed under this CAS number, including other names
Benzyl (piperidin-4-ylmethyl)carbamate, 95%, 95% (CAS 132431-09-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11919F-100mg |
| cas | 132431-09-5 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 500mg | 165.20 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 419.60 Pln | |
| Chemat | 10g | 611.60 Pln | |
| Chemat | 25g | 1096.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl N-(piperidin-4-ylmethyl)carbamate (CAS 132431-09-5) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl N-(piperidin-4-ylmethyl)carbamate. InChIKey: BZHPVEHRXAKHMV-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl N-(piperidin-4-ylmethyl)carbamate |
| InChIKey | BZHPVEHRXAKHMV-UHFFFAOYSA-N |
| SMILES | C1CNCCC1CNC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)