cas: 1523571-82-5 — see every product listed under this CAS number, including other names
Benzyl 1,7-diazaspiro[4.5]decane-1-carboxylate hydrochloride, 97%, 97% (CAS 1523571-82-5) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXZZ-500mg |
| cas | 1523571-82-5 |
| size | 500mg |
| availability | 19.48g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 1528.40 Pln | |
| Chemat | 1g | 2238.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl 1,9-diazaspiro[4.5]decane-1-carboxylate;hydrochloride (CAS 1523571-82-5) is a chemical compound with the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. IUPAC name: benzyl 1,9-diazaspiro[4.5]decane-1-carboxylate;hydrochloride. InChIKey: IUZFRBWCAMPBTR-UHFFFAOYSA-N.
| Molecular formula | C16H23ClN2O2 |
|---|---|
| Molecular weight | 310.82 g/mol |
| IUPAC name | benzyl 1,9-diazaspiro[4.5]decane-1-carboxylate;hydrochloride |
| InChIKey | IUZFRBWCAMPBTR-UHFFFAOYSA-N |
| SMILES | C1CC2(CCCN2C(=O)OCC3=CC=CC=C3)CNC1.Cl |
Computed by PubChem (NCBI)