cas: 57783-76-3 — see every product listed under this CAS number, including other names
Benzyl 2,3,4-tri-O-benzyl-α-D-mannopyranoside (CAS 57783-76-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM39060C-100mg |
| cas | 57783-76-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1286.35 Pln | |
| Chemat | 1g | 5587.99 Pln | |
| Chemat | 250mg | 2027.60 Pln | |
| Chemat | 500mg | 3362.49 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
[(2R,3R,4S,5S,6S)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]methanol (CAS 57783-76-3) is a chemical compound with the molecular formula C34H36O6 and a molecular weight of 540.6 g/mol. IUPAC name: [(2R,3R,4S,5S,6S)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]methanol. InChIKey: HYWPIYGUZWWMDH-ZOHVZMGWSA-N.
| Molecular formula | C34H36O6 |
|---|---|
| Molecular weight | 540.6 g/mol |
| IUPAC name | [(2R,3R,4S,5S,6S)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]methanol |
| InChIKey | HYWPIYGUZWWMDH-ZOHVZMGWSA-N |
| SMILES | C1=CC=C(C=C1)CO[C@@H]2[C@H](O[C@@H]([C@H]([C@H]2OCC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5)CO |
Computed by PubChem (NCBI)