cas: 1256360-11-8 — see every product listed under this CAS number, including other names
Benzyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-1-carboxylate 98% (CAS 1256360-11-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A143850-250mg |
| cas | 1256360-11-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 1193.62 Pln | |
| Ambeed | 5g | 4547.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A143850 |
Benzyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate (CAS 1256360-11-8) is a chemical compound with the molecular formula C18H22BNO4 and a molecular weight of 327.2 g/mol. IUPAC name: benzyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate. InChIKey: MHUYEVSKFAMONG-UHFFFAOYSA-N.
| Molecular formula | C18H22BNO4 |
|---|---|
| Molecular weight | 327.2 g/mol |
| IUPAC name | benzyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate |
| InChIKey | MHUYEVSKFAMONG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C=C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)